C21H28ClNO4 — CID 20599056
7-[(2R)-2-[(3S)-4-(3-chlorophenyl)-3-hydroxybut-1-enyl]-5-oxopyrrolidin-1-yl]heptanoic acid (PubChem CID 20599056) has the molecular formula C21H28ClNO4 and a molecular weight of 393.91 g/mol. Its IUPAC name is 7-[(2R)-2-[(3S)-4-(3-chlorophenyl)-3-hydroxybut-1-enyl]-5-oxopyrrolidin-1-yl]heptanoic acid.
| Compound Name | 7-[(2R)-2-[(3S)-4-(3-chlorophenyl)-3-hydroxybut-1-enyl]-5-oxopyrrolidin-1-yl]heptanoic acid |
|---|---|
| PubChem CID | 20599056 |
| Molecular Formula | C21H28ClNO4 |
| Molecular Weight | 393.91 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | 7-[(2R)-2-[(3S)-4-(3-chlorophenyl)-3-hydroxybut-1-enyl]-5-oxopyrrolidin-1-yl]heptanoic acid |
| SMILES | O=C(O)CCCCCCN1C(=O)CC[C@@H]1C=C[C@@H](O)Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C21H28ClNO4/c22-17-7-5-6-16(14-17)15-19(24)11-9-18-10-12-20(25)23(18)13-4-2-1-3-8-21(26)27/h5-7,9,11,14,18-19,24H,1-4,8,10,12-13,15H2,(H,26,27)/t18-,19+/m0/s1 |
| InChIKey | CXIPEQJFZZYNQE-RBUKOAKNSA-N |
| XLogP | 3.83 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.91 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|