C20H26ClNO3S — CID 147986098
7-[2-[(E)-2-[(3-chlorophenyl)methylsulfanyl]ethenyl]-5-oxopyrrolidin-1-yl]heptanoic acid (PubChem CID 147986098) has the molecular formula C20H26ClNO3S and a molecular weight of 395.95 g/mol. Its IUPAC name is 7-[2-[(E)-2-[(3-chlorophenyl)methylsulfanyl]ethenyl]-5-oxopyrrolidin-1-yl]heptanoic acid.
| Compound Name | 7-[2-[(E)-2-[(3-chlorophenyl)methylsulfanyl]ethenyl]-5-oxopyrrolidin-1-yl]heptanoic acid |
|---|---|
| PubChem CID | 147986098 |
| Molecular Formula | C20H26ClNO3S |
| Molecular Weight | 395.95 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | 7-[2-[(E)-2-[(3-chlorophenyl)methylsulfanyl]ethenyl]-5-oxopyrrolidin-1-yl]heptanoic acid |
| SMILES | O=C(O)CCCCCCN1C(=O)CCC1/C=C/SCc1cccc(Cl)c1 |
| InChI | InChI=1S/C20H26ClNO3S/c21-17-7-5-6-16(14-17)15-26-13-11-18-9-10-19(23)22(18)12-4-2-1-3-8-20(24)25/h5-7,11,13-14,18H,1-4,8-10,12,15H2,(H,24,25)/b13-11+ |
| InChIKey | IUDVKBZFSAMHJY-ACCUITESSA-N |
| XLogP | 5.11 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.95 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|