C13H21NO3 — CID 167175811
7-[(2R)-2-ethenyl-5-oxopyrrolidin-1-yl]heptanoic acid (PubChem CID 167175811) has the molecular formula C13H21NO3 and a molecular weight of 239.31 g/mol. Its IUPAC name is 7-[(2R)-2-ethenyl-5-oxopyrrolidin-1-yl]heptanoic acid.
| Compound Name | 7-[(2R)-2-ethenyl-5-oxopyrrolidin-1-yl]heptanoic acid |
|---|---|
| PubChem CID | 167175811 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | 7-[(2R)-2-ethenyl-5-oxopyrrolidin-1-yl]heptanoic acid |
| SMILES | C=C[C@H]1CCC(=O)N1CCCCCCC(=O)O |
| InChI | InChI=1S/C13H21NO3/c1-2-11-8-9-12(15)14(11)10-6-4-3-5-7-13(16)17/h2,11H,1,3-10H2,(H,16,17)/t11-/m0/s1 |
| InChIKey | IAWVTFKKACESNX-NSHDSACASA-N |
| XLogP | 2.20 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|