C24H31NO3 — CID 129111476
7-[2-oxo-5-[(E)-7-phenylhept-1-en-6-ynyl]pyrrolidin-1-yl]heptanoic acid (PubChem CID 129111476) has the molecular formula C24H31NO3 and a molecular weight of 381.52 g/mol. Its IUPAC name is 7-[2-oxo-5-[(E)-7-phenylhept-1-en-6-ynyl]pyrrolidin-1-yl]heptanoic acid.
| Compound Name | 7-[2-oxo-5-[(E)-7-phenylhept-1-en-6-ynyl]pyrrolidin-1-yl]heptanoic acid |
|---|---|
| PubChem CID | 129111476 |
| Molecular Formula | C24H31NO3 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.23 |
| IUPAC Name | 7-[2-oxo-5-[(E)-7-phenylhept-1-en-6-ynyl]pyrrolidin-1-yl]heptanoic acid |
| SMILES | O=C(O)CCCCCCN1C(=O)CCC1/C=C/CCCC#Cc1ccccc1 |
| InChI | InChI=1S/C24H31NO3/c26-23-19-18-22(25(23)20-12-5-4-11-17-24(27)28)16-10-3-1-2-7-13-21-14-8-6-9-15-21/h6,8-10,14-16,22H,1-5,11-12,17-20H2,(H,27,28)/b16-10+ |
| InChIKey | BHRFKBXAJXLDTG-MHWRWJLKSA-N |
| XLogP | 4.79 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|