C26H35NO4 — CID 118896960
methyl 7-[(2R)-2-[(3S,4R)-3-hydroxy-4-methyl-7-phenylhept-1-en-6-ynyl]-5-oxopyrrolidin-1-yl]heptanoate (PubChem CID 118896960) has the molecular formula C26H35NO4 and a molecular weight of 425.57 g/mol. Its IUPAC name is methyl 7-[(2R)-2-[(3S,4R)-3-hydroxy-4-methyl-7-phenylhept-1-en-6-ynyl]-5-oxopyrrolidin-1-yl]heptanoate.
| Compound Name | methyl 7-[(2R)-2-[(3S,4R)-3-hydroxy-4-methyl-7-phenylhept-1-en-6-ynyl]-5-oxopyrrolidin-1-yl]heptanoate |
|---|---|
| PubChem CID | 118896960 |
| Molecular Formula | C26H35NO4 |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 425.26 |
| IUPAC Name | methyl 7-[(2R)-2-[(3S,4R)-3-hydroxy-4-methyl-7-phenylhept-1-en-6-ynyl]-5-oxopyrrolidin-1-yl]heptanoate |
| SMILES | COC(=O)CCCCCCN1C(=O)CC[C@@H]1C=C[C@@H](O)[C@H](C)CC#Cc1ccccc1 |
| InChI | InChI=1S/C26H35NO4/c1-21(11-10-14-22-12-6-5-7-13-22)24(28)18-16-23-17-19-25(29)27(23)20-9-4-3-8-15-26(30)31-2/h5-7,12-13,16,18,21,23-24,28H,3-4,8-9,11,15,17,19-20H2,1-2H3/t21-,23+,24-/m1/s1 |
| InChIKey | WMZRIOLCANOJPR-YFNKSVMNSA-N |
| XLogP | 4.10 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|