C29H33NO4 — CID 118897023
methyl 3-[3-[(2R)-2-[(3R,4S)-3-hydroxy-4-methyl-7-phenylhept-1-en-6-ynyl]-5-oxopyrrolidin-1-yl]propyl]benzoate (PubChem CID 118897023) has the molecular formula C29H33NO4 and a molecular weight of 459.59 g/mol. Its IUPAC name is methyl 3-[3-[(2R)-2-[(3R,4S)-3-hydroxy-4-methyl-7-phenylhept-1-en-6-ynyl]-5-oxopyrrolidin-1-yl]propyl]benzoate.
| Compound Name | methyl 3-[3-[(2R)-2-[(3R,4S)-3-hydroxy-4-methyl-7-phenylhept-1-en-6-ynyl]-5-oxopyrrolidin-1-yl]propyl]benzoate |
|---|---|
| PubChem CID | 118897023 |
| Molecular Formula | C29H33NO4 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.24 |
| IUPAC Name | methyl 3-[3-[(2R)-2-[(3R,4S)-3-hydroxy-4-methyl-7-phenylhept-1-en-6-ynyl]-5-oxopyrrolidin-1-yl]propyl]benzoate |
| SMILES | COC(=O)c1cccc(CCCN2C(=O)CC[C@@H]2C=C[C@H](O)[C@@H](C)CC#Cc2ccccc2)c1 |
| InChI | InChI=1S/C29H33NO4/c1-22(9-6-12-23-10-4-3-5-11-23)27(31)18-16-26-17-19-28(32)30(26)20-8-14-24-13-7-15-25(21-24)29(33)34-2/h3-5,7,10-11,13,15-16,18,21-22,26-27,31H,8-9,14,17,19-20H2,1-2H3/t22-,26-,27-/m0/s1 |
| InChIKey | VLXJZVZOAKCKHK-CAVYSCNFSA-N |
| XLogP | 4.39 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|