C28H31NO3 — CID 163412202
4-[2-[(2R)-2-[(E,3R)-3,4-dimethyl-7-phenylhept-1-en-6-ynyl]-5-oxopyrrolidin-1-yl]ethyl]benzoic acid (PubChem CID 163412202) has the molecular formula C28H31NO3 and a molecular weight of 429.56 g/mol. Its IUPAC name is 4-[2-[(2R)-2-[(E,3R)-3,4-dimethyl-7-phenylhept-1-en-6-ynyl]-5-oxopyrrolidin-1-yl]ethyl]benzoic acid.
| Compound Name | 4-[2-[(2R)-2-[(E,3R)-3,4-dimethyl-7-phenylhept-1-en-6-ynyl]-5-oxopyrrolidin-1-yl]ethyl]benzoic acid |
|---|---|
| PubChem CID | 163412202 |
| Molecular Formula | C28H31NO3 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | 4-[2-[(2R)-2-[(E,3R)-3,4-dimethyl-7-phenylhept-1-en-6-ynyl]-5-oxopyrrolidin-1-yl]ethyl]benzoic acid |
| SMILES | CC(CC#Cc1ccccc1)[C@@H](C)/C=C/[C@H]1CCC(=O)N1CCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C28H31NO3/c1-21(7-6-10-23-8-4-3-5-9-23)22(2)11-16-26-17-18-27(30)29(26)20-19-24-12-14-25(15-13-24)28(31)32/h3-5,8-9,11-16,21-22,26H,7,17-20H2,1-2H3,(H,31,32)/b16-11+/t21?,22-,26-/m0/s1 |
| InChIKey | ABLFTZDQCFXJOY-NJHVQQEMSA-N |
| XLogP | 5.19 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|