C23H25NO5 — CID 59788370
4-[2-[(2R)-2-[(E,3R)-3-hydroxy-4-phenoxybut-1-enyl]-5-oxopyrrolidin-1-yl]ethyl]benzoic acid (PubChem CID 59788370) has the molecular formula C23H25NO5 and a molecular weight of 395.46 g/mol. Its IUPAC name is 4-[2-[(2R)-2-[(E,3R)-3-hydroxy-4-phenoxybut-1-enyl]-5-oxopyrrolidin-1-yl]ethyl]benzoic acid.
| Compound Name | 4-[2-[(2R)-2-[(E,3R)-3-hydroxy-4-phenoxybut-1-enyl]-5-oxopyrrolidin-1-yl]ethyl]benzoic acid |
|---|---|
| PubChem CID | 59788370 |
| Molecular Formula | C23H25NO5 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | 4-[2-[(2R)-2-[(E,3R)-3-hydroxy-4-phenoxybut-1-enyl]-5-oxopyrrolidin-1-yl]ethyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CCN2C(=O)CC[C@@H]2/C=C/[C@@H](O)COc2ccccc2)cc1 |
| InChI | InChI=1S/C23H25NO5/c25-20(16-29-21-4-2-1-3-5-21)12-10-19-11-13-22(26)24(19)15-14-17-6-8-18(9-7-17)23(27)28/h1-10,12,19-20,25H,11,13-16H2,(H,27,28)/b12-10+/t19-,20+/m0/s1 |
| InChIKey | CHAKDELPWMZORW-QUJGQYFQSA-N |
| XLogP | 2.91 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|