C23H24FNO4 — CID 10453415
4-[2-[(2R)-2-[(E,3S)-4-(4-fluorophenyl)-3-hydroxybut-1-enyl]-5-oxopyrrolidin-1-yl]ethyl]benzoic acid (PubChem CID 10453415) has the molecular formula C23H24FNO4 and a molecular weight of 397.45 g/mol. Its IUPAC name is 4-[2-[(2R)-2-[(E,3S)-4-(4-fluorophenyl)-3-hydroxybut-1-enyl]-5-oxopyrrolidin-1-yl]ethyl]benzoic acid.
| Compound Name | 4-[2-[(2R)-2-[(E,3S)-4-(4-fluorophenyl)-3-hydroxybut-1-enyl]-5-oxopyrrolidin-1-yl]ethyl]benzoic acid |
|---|---|
| PubChem CID | 10453415 |
| Molecular Formula | C23H24FNO4 |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | 4-[2-[(2R)-2-[(E,3S)-4-(4-fluorophenyl)-3-hydroxybut-1-enyl]-5-oxopyrrolidin-1-yl]ethyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CCN2C(=O)CC[C@@H]2/C=C/[C@@H](O)Cc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C23H24FNO4/c24-19-7-3-17(4-8-19)15-21(26)11-9-20-10-12-22(27)25(20)14-13-16-1-5-18(6-2-16)23(28)29/h1-9,11,20-21,26H,10,12-15H2,(H,28,29)/b11-9+/t20-,21+/m0/s1 |
| InChIKey | MRRMYSDUIZVBAH-LUOTYQEOSA-N |
| XLogP | 3.22 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|