C22H24FNO5 — CID 90874034
5-[3-[(2R)-2-[(3S)-4-(4-fluorophenyl)-3-hydroxybut-1-enyl]-5-oxopyrrolidin-1-yl]propyl]furan-2-carboxylic acid (PubChem CID 90874034) has the molecular formula C22H24FNO5 and a molecular weight of 401.43 g/mol. Its IUPAC name is 5-[3-[(2R)-2-[(3S)-4-(4-fluorophenyl)-3-hydroxybut-1-enyl]-5-oxopyrrolidin-1-yl]propyl]furan-2-carboxylic acid.
| Compound Name | 5-[3-[(2R)-2-[(3S)-4-(4-fluorophenyl)-3-hydroxybut-1-enyl]-5-oxopyrrolidin-1-yl]propyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 90874034 |
| Molecular Formula | C22H24FNO5 |
| Molecular Weight | 401.43 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | 5-[3-[(2R)-2-[(3S)-4-(4-fluorophenyl)-3-hydroxybut-1-enyl]-5-oxopyrrolidin-1-yl]propyl]furan-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(CCCN2C(=O)CC[C@@H]2C=C[C@@H](O)Cc2ccc(F)cc2)o1 |
| InChI | InChI=1S/C22H24FNO5/c23-16-5-3-15(4-6-16)14-18(25)9-7-17-8-12-21(26)24(17)13-1-2-19-10-11-20(29-19)22(27)28/h3-7,9-11,17-18,25H,1-2,8,12-14H2,(H,27,28)/t17-,18+/m0/s1 |
| InChIKey | SLBGUXORLPLWIY-ZWKOTPCHSA-N |
| XLogP | 3.20 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.43 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|