C30H39NO4 — CID 118691740
methyl 4-[2-[(2R)-2-[(E,3S,4S)-3-hydroxy-4-methyl-9-phenylnon-1-enyl]-5-oxopyrrolidin-1-yl]ethyl]benzoate (PubChem CID 118691740) has the molecular formula C30H39NO4 and a molecular weight of 477.65 g/mol. Its IUPAC name is methyl 4-[2-[(2R)-2-[(E,3S,4S)-3-hydroxy-4-methyl-9-phenylnon-1-enyl]-5-oxopyrrolidin-1-yl]ethyl]benzoate.
| Compound Name | methyl 4-[2-[(2R)-2-[(E,3S,4S)-3-hydroxy-4-methyl-9-phenylnon-1-enyl]-5-oxopyrrolidin-1-yl]ethyl]benzoate |
|---|---|
| PubChem CID | 118691740 |
| Molecular Formula | C30H39NO4 |
| Molecular Weight | 477.65 g/mol |
| Exact Mass | 477.29 |
| IUPAC Name | methyl 4-[2-[(2R)-2-[(E,3S,4S)-3-hydroxy-4-methyl-9-phenylnon-1-enyl]-5-oxopyrrolidin-1-yl]ethyl]benzoate |
| SMILES | COC(=O)c1ccc(CCN2C(=O)CC[C@@H]2/C=C/[C@@H](O)[C@@H](C)CCCCCc2ccccc2)cc1 |
| InChI | InChI=1S/C30H39NO4/c1-23(9-5-3-6-10-24-11-7-4-8-12-24)28(32)19-17-27-18-20-29(33)31(27)22-21-25-13-15-26(16-14-25)30(34)35-2/h4,7-8,11-17,19,23,27-28,32H,3,5-6,9-10,18,20-22H2,1-2H3/b19-17+/t23-,27-,28+/m0/s1 |
| InChIKey | WOXPQFWPZBLTKE-IBNXKKLCSA-N |
| XLogP | 5.36 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.65 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|