C27H35NO4S — CID 118691715
5-[3-[(2R)-2-[(3S,4S)-3-hydroxy-4-methyl-8-phenyloct-1-enyl]-5-oxopyrrolidin-1-yl]propyl]thiophene-2-carboxylic acid (PubChem CID 118691715) has the molecular formula C27H35NO4S and a molecular weight of 469.65 g/mol. Its IUPAC name is 5-[3-[(2R)-2-[(3S,4S)-3-hydroxy-4-methyl-8-phenyloct-1-enyl]-5-oxopyrrolidin-1-yl]propyl]thiophene-2-carboxylic acid.
| Compound Name | 5-[3-[(2R)-2-[(3S,4S)-3-hydroxy-4-methyl-8-phenyloct-1-enyl]-5-oxopyrrolidin-1-yl]propyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 118691715 |
| Molecular Formula | C27H35NO4S |
| Molecular Weight | 469.65 g/mol |
| Exact Mass | 469.23 |
| IUPAC Name | 5-[3-[(2R)-2-[(3S,4S)-3-hydroxy-4-methyl-8-phenyloct-1-enyl]-5-oxopyrrolidin-1-yl]propyl]thiophene-2-carboxylic acid |
| SMILES | C[C@@H](CCCCc1ccccc1)[C@H](O)C=C[C@H]1CCC(=O)N1CCCc1ccc(C(=O)O)s1 |
| InChI | InChI=1S/C27H35NO4S/c1-20(8-5-6-11-21-9-3-2-4-10-21)24(29)16-13-22-14-18-26(30)28(22)19-7-12-23-15-17-25(33-23)27(31)32/h2-4,9-10,13,15-17,20,22,24,29H,5-8,11-12,14,18-19H2,1H3,(H,31,32)/t20-,22-,24+/m0/s1 |
| InChIKey | ATRZOBDJGRNPEF-ODGPQVTHSA-N |
| XLogP | 5.34 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.65 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|