C28H39NO4S — CID 118691896
5-[3-[2-[(3R,4S)-3-hydroxy-4-methyl-9-phenylnonyl]-5-oxopyrrolidin-1-yl]propyl]thiophene-2-carboxylic acid (PubChem CID 118691896) has the molecular formula C28H39NO4S and a molecular weight of 485.69 g/mol. Its IUPAC name is 5-[3-[2-[(3R,4S)-3-hydroxy-4-methyl-9-phenylnonyl]-5-oxopyrrolidin-1-yl]propyl]thiophene-2-carboxylic acid.
| Compound Name | 5-[3-[2-[(3R,4S)-3-hydroxy-4-methyl-9-phenylnonyl]-5-oxopyrrolidin-1-yl]propyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 118691896 |
| Molecular Formula | C28H39NO4S |
| Molecular Weight | 485.69 g/mol |
| Exact Mass | 485.26 |
| IUPAC Name | 5-[3-[2-[(3R,4S)-3-hydroxy-4-methyl-9-phenylnonyl]-5-oxopyrrolidin-1-yl]propyl]thiophene-2-carboxylic acid |
| SMILES | C[C@@H](CCCCCc1ccccc1)[C@H](O)CCC1CCC(=O)N1CCCc1ccc(C(=O)O)s1 |
| InChI | InChI=1S/C28H39NO4S/c1-21(9-4-2-5-10-22-11-6-3-7-12-22)25(30)17-14-23-15-19-27(31)29(23)20-8-13-24-16-18-26(34-24)28(32)33/h3,6-7,11-12,16,18,21,23,25,30H,2,4-5,8-10,13-15,17,19-20H2,1H3,(H,32,33)/t21-,23?,25+/m0/s1 |
| InChIKey | QBQXUPCTRXTTAW-KVCNQYIISA-N |
| XLogP | 5.95 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.69 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|