C24H29NO4S — CID 90454928
5-[3-[(2R)-2-[(E,3S)-3-hydroxy-6-phenylhex-1-enyl]-5-oxopyrrolidin-1-yl]propyl]thiophene-2-carboxylic acid (PubChem CID 90454928) has the molecular formula C24H29NO4S and a molecular weight of 427.57 g/mol. Its IUPAC name is 5-[3-[(2R)-2-[(E,3S)-3-hydroxy-6-phenylhex-1-enyl]-5-oxopyrrolidin-1-yl]propyl]thiophene-2-carboxylic acid.
| Compound Name | 5-[3-[(2R)-2-[(E,3S)-3-hydroxy-6-phenylhex-1-enyl]-5-oxopyrrolidin-1-yl]propyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 90454928 |
| Molecular Formula | C24H29NO4S |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | 5-[3-[(2R)-2-[(E,3S)-3-hydroxy-6-phenylhex-1-enyl]-5-oxopyrrolidin-1-yl]propyl]thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(CCCN2C(=O)CC[C@@H]2/C=C/[C@@H](O)CCCc2ccccc2)s1 |
| InChI | InChI=1S/C24H29NO4S/c26-20(9-4-8-18-6-2-1-3-7-18)13-11-19-12-16-23(27)25(19)17-5-10-21-14-15-22(30-21)24(28)29/h1-3,6-7,11,13-15,19-20,26H,4-5,8-10,12,16-17H2,(H,28,29)/b13-11+/t19-,20-/m0/s1 |
| InChIKey | KURSFULHIVDSJT-IALFWVKVSA-N |
| XLogP | 4.31 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|