C22H31NO4S — CID 118896750
5-[3-[2-[(3R,4R)-3-hydroxy-4-methylnon-6-ynyl]-5-oxopyrrolidin-1-yl]propyl]thiophene-2-carboxylic acid (PubChem CID 118896750) has the molecular formula C22H31NO4S and a molecular weight of 405.56 g/mol. Its IUPAC name is 5-[3-[2-[(3R,4R)-3-hydroxy-4-methylnon-6-ynyl]-5-oxopyrrolidin-1-yl]propyl]thiophene-2-carboxylic acid.
| Compound Name | 5-[3-[2-[(3R,4R)-3-hydroxy-4-methylnon-6-ynyl]-5-oxopyrrolidin-1-yl]propyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 118896750 |
| Molecular Formula | C22H31NO4S |
| Molecular Weight | 405.56 g/mol |
| Exact Mass | 405.20 |
| IUPAC Name | 5-[3-[2-[(3R,4R)-3-hydroxy-4-methylnon-6-ynyl]-5-oxopyrrolidin-1-yl]propyl]thiophene-2-carboxylic acid |
| SMILES | CCC#CC[C@@H](C)[C@H](O)CCC1CCC(=O)N1CCCc1ccc(C(=O)O)s1 |
| InChI | InChI=1S/C22H31NO4S/c1-3-4-5-7-16(2)19(24)12-9-17-10-14-21(25)23(17)15-6-8-18-11-13-20(28-18)22(26)27/h11,13,16-17,19,24H,3,6-10,12,14-15H2,1-2H3,(H,26,27)/t16-,17?,19-/m1/s1 |
| InChIKey | KDVOTHZTFMHXGL-IRQCGSAXSA-N |
| XLogP | 3.95 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.56 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|