About methyl 7-[2-[(3S,4S)-3-hydroxy-4-methylnon-6-ynyl]-5-oxopyrrolidin-1-yl]heptanoate
methyl 7-[2-[(3S,4S)-3-hydroxy-4-methylnon-6-ynyl]-5-oxopyrrolidin-1-yl]heptanoate (PubChem CID 118896896) has the molecular formula C22H37NO4
and a molecular weight of 379.54 g/mol. Its IUPAC name is methyl 7-[2-[(3S,4S)-3-hydroxy-4-methylnon-6-ynyl]-5-oxopyrrolidin-1-yl]heptanoate.
Molecular Properties
| Compound Name | methyl 7-[2-[(3S,4S)-3-hydroxy-4-methylnon-6-ynyl]-5-oxopyrrolidin-1-yl]heptanoate |
| PubChem CID | 118896896 |
| Molecular Formula | C22H37NO4 |
| Molecular Weight | 379.54 g/mol |
| Exact Mass | 379.27 |
| IUPAC Name | methyl 7-[2-[(3S,4S)-3-hydroxy-4-methylnon-6-ynyl]-5-oxopyrrolidin-1-yl]heptanoate |
| SMILES | CCC#CC[C@H](C)[C@@H](O)CCC1CCC(=O)N1CCCCCCC(=O)OC |
| InChI | InChI=1S/C22H37NO4/c1-4-5-8-11-18(2)20(24)15-13-19-14-16-21(25)23(19)17-10-7-6-9-12-22(26)27-3/h18-20,24H,4,6-7,9-17H2,1-3H3/t18-,19?,20-/m0/s1 |
| InChIKey | JTLRKIGJTKOWSW-WMEOFMBSSA-N |
| XLogP | 3.68 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.54 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl 7-[2-[(3S,4S)-3-hydroxy-4-methylnon-6-ynyl]-5-oxopyrrolidin-1-yl]heptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 7-[2-[(3S,4S)-3-hydroxy-4-methylnon-6-ynyl]-5-oxopyrrolidin-1-yl]heptanoate?
The IUPAC name of methyl 7-[2-[(3S,4S)-3-hydroxy-4-methylnon-6-ynyl]-5-oxopyrrolidin-1-yl]heptanoate (CID 118896896) is methyl 7-[2-[(3S,4S)-3-hydroxy-4-methylnon-6-ynyl]-5-oxopyrrolidin-1-yl]heptanoate.
What is the SMILES notation for methyl 7-[2-[(3S,4S)-3-hydroxy-4-methylnon-6-ynyl]-5-oxopyrrolidin-1-yl]heptanoate?
The canonical SMILES for methyl 7-[2-[(3S,4S)-3-hydroxy-4-methylnon-6-ynyl]-5-oxopyrrolidin-1-yl]heptanoate is CCC#CC[C@H](C)[C@@H](O)CCC1CCC(=O)N1CCCCCCC(=O)OC.
What is the InChIKey of methyl 7-[2-[(3S,4S)-3-hydroxy-4-methylnon-6-ynyl]-5-oxopyrrolidin-1-yl]heptanoate?
The InChIKey is JTLRKIGJTKOWSW-WMEOFMBSSA-N. The full InChI is InChI=1S/C22H37NO4/c1-4-5-8-11-18(2)20(24)15-13-19-14-16-21(25)23(19)17-10-7-6-9-12-22(26)27-3/h18-20,24H,4,6-7,9-17H2,1-3H3/t18-,19?,20-/m0/s1.
What are the key properties of methyl 7-[2-[(3S,4S)-3-hydroxy-4-methylnon-6-ynyl]-5-oxopyrrolidin-1-yl]heptanoate?
methyl 7-[2-[(3S,4S)-3-hydroxy-4-methylnon-6-ynyl]-5-oxopyrrolidin-1-yl]heptanoate has a molecular weight of 379.54 g/mol, XLogP of 3.68, 12 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 7-[2-[(3S,4S)-3-hydroxy-4-methylnon-6-ynyl]-5-oxopyrrolidin-1-yl]heptanoate is sourced from PubChem (CID 118896896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).