C23H37NO4 — CID 86295957
methyl 7-[(2R)-2-[(E,3R)-3-hydroxy-4,4-dimethylnon-1-en-6-ynyl]-5-oxopyrrolidin-1-yl]heptanoate (PubChem CID 86295957) has the molecular formula C23H37NO4 and a molecular weight of 391.55 g/mol. Its IUPAC name is methyl 7-[(2R)-2-[(E,3R)-3-hydroxy-4,4-dimethylnon-1-en-6-ynyl]-5-oxopyrrolidin-1-yl]heptanoate.
| Compound Name | methyl 7-[(2R)-2-[(E,3R)-3-hydroxy-4,4-dimethylnon-1-en-6-ynyl]-5-oxopyrrolidin-1-yl]heptanoate |
|---|---|
| PubChem CID | 86295957 |
| Molecular Formula | C23H37NO4 |
| Molecular Weight | 391.55 g/mol |
| Exact Mass | 391.27 |
| IUPAC Name | methyl 7-[(2R)-2-[(E,3R)-3-hydroxy-4,4-dimethylnon-1-en-6-ynyl]-5-oxopyrrolidin-1-yl]heptanoate |
| SMILES | CCC#CCC(C)(C)[C@H](O)/C=C/[C@H]1CCC(=O)N1CCCCCCC(=O)OC |
| InChI | InChI=1S/C23H37NO4/c1-5-6-10-17-23(2,3)20(25)15-13-19-14-16-21(26)24(19)18-11-8-7-9-12-22(27)28-4/h13,15,19-20,25H,5,7-9,11-12,14,16-18H2,1-4H3/b15-13+/t19-,20+/m0/s1 |
| InChIKey | LJJNCVIWNFPFTG-VIDFKJSCSA-N |
| XLogP | 3.85 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.55 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|