C22H36N2O5S — CID 118897098
7-[(2R)-2-[(3S,4S)-3-hydroxy-4-methylnon-1-en-6-ynyl]-5-oxopyrrolidin-1-yl]-N-methylsulfonylheptanamide (PubChem CID 118897098) has the molecular formula C22H36N2O5S and a molecular weight of 440.61 g/mol. Its IUPAC name is 7-[(2R)-2-[(3S,4S)-3-hydroxy-4-methylnon-1-en-6-ynyl]-5-oxopyrrolidin-1-yl]-N-methylsulfonylheptanamide.
| Compound Name | 7-[(2R)-2-[(3S,4S)-3-hydroxy-4-methylnon-1-en-6-ynyl]-5-oxopyrrolidin-1-yl]-N-methylsulfonylheptanamide |
|---|---|
| PubChem CID | 118897098 |
| Molecular Formula | C22H36N2O5S |
| Molecular Weight | 440.61 g/mol |
| Exact Mass | 440.23 |
| IUPAC Name | 7-[(2R)-2-[(3S,4S)-3-hydroxy-4-methylnon-1-en-6-ynyl]-5-oxopyrrolidin-1-yl]-N-methylsulfonylheptanamide |
| SMILES | CCC#CC[C@H](C)[C@H](O)C=C[C@H]1CCC(=O)N1CCCCCCC(=O)NS(C)(=O)=O |
| InChI | InChI=1S/C22H36N2O5S/c1-4-5-8-11-18(2)20(25)15-13-19-14-16-22(27)24(19)17-10-7-6-9-12-21(26)23-30(3,28)29/h13,15,18-20,25H,4,6-7,9-12,14,16-17H2,1-3H3,(H,23,26)/t18-,19-,20+/m0/s1 |
| InChIKey | MVWHXRWUAFNXPI-SLFFLAALSA-N |
| XLogP | 2.36 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.61 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|