C24H39NO4 — CID 86295956
methyl 7-[(2R)-2-[(E,3R,4R)-3-hydroxy-4-propan-2-ylnon-1-en-6-ynyl]-5-oxopyrrolidin-1-yl]heptanoate (PubChem CID 86295956) has the molecular formula C24H39NO4 and a molecular weight of 405.58 g/mol. Its IUPAC name is methyl 7-[(2R)-2-[(E,3R,4R)-3-hydroxy-4-propan-2-ylnon-1-en-6-ynyl]-5-oxopyrrolidin-1-yl]heptanoate.
| Compound Name | methyl 7-[(2R)-2-[(E,3R,4R)-3-hydroxy-4-propan-2-ylnon-1-en-6-ynyl]-5-oxopyrrolidin-1-yl]heptanoate |
|---|---|
| PubChem CID | 86295956 |
| Molecular Formula | C24H39NO4 |
| Molecular Weight | 405.58 g/mol |
| Exact Mass | 405.29 |
| IUPAC Name | methyl 7-[(2R)-2-[(E,3R,4R)-3-hydroxy-4-propan-2-ylnon-1-en-6-ynyl]-5-oxopyrrolidin-1-yl]heptanoate |
| SMILES | CCC#CC[C@H](C(C)C)[C@H](O)/C=C/[C@H]1CCC(=O)N1CCCCCCC(=O)OC |
| InChI | InChI=1S/C24H39NO4/c1-5-6-9-12-21(19(2)3)22(26)16-14-20-15-17-23(27)25(20)18-11-8-7-10-13-24(28)29-4/h14,16,19-22,26H,5,7-8,10-13,15,17-18H2,1-4H3/b16-14+/t20-,21+,22+/m0/s1 |
| InChIKey | ACAZRBWYQJKXES-QRVHACKSSA-N |
| XLogP | 4.09 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.58 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|