C22H35NO4S — CID 118896858
methyl 4-[2-[(2R)-2-[(3R,4S)-3-hydroxy-4-methyldec-1-en-6-ynyl]-5-oxopyrrolidin-1-yl]ethylsulfanyl]butanoate (PubChem CID 118896858) has the molecular formula C22H35NO4S and a molecular weight of 409.59 g/mol. Its IUPAC name is methyl 4-[2-[(2R)-2-[(3R,4S)-3-hydroxy-4-methyldec-1-en-6-ynyl]-5-oxopyrrolidin-1-yl]ethylsulfanyl]butanoate.
| Compound Name | methyl 4-[2-[(2R)-2-[(3R,4S)-3-hydroxy-4-methyldec-1-en-6-ynyl]-5-oxopyrrolidin-1-yl]ethylsulfanyl]butanoate |
|---|---|
| PubChem CID | 118896858 |
| Molecular Formula | C22H35NO4S |
| Molecular Weight | 409.59 g/mol |
| Exact Mass | 409.23 |
| IUPAC Name | methyl 4-[2-[(2R)-2-[(3R,4S)-3-hydroxy-4-methyldec-1-en-6-ynyl]-5-oxopyrrolidin-1-yl]ethylsulfanyl]butanoate |
| SMILES | CCCC#CC[C@H](C)[C@@H](O)C=C[C@H]1CCC(=O)N1CCSCCCC(=O)OC |
| InChI | InChI=1S/C22H35NO4S/c1-4-5-6-7-9-18(2)20(24)13-11-19-12-14-21(25)23(19)15-17-28-16-8-10-22(26)27-3/h11,13,18-20,24H,4-5,8-10,12,14-17H2,1-3H3/t18-,19-,20-/m0/s1 |
| InChIKey | LOEUJHGORNUWIK-UFYCRDLUSA-N |
| XLogP | 3.41 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.59 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|