C21H33NO4S — CID 86296959
methyl 4-[2-[(2R)-2-[(E,3S,4S)-3-hydroxy-4-methylnon-1-en-6-ynyl]-5-oxopyrrolidin-1-yl]ethylsulfanyl]butanoate (PubChem CID 86296959) has the molecular formula C21H33NO4S and a molecular weight of 395.57 g/mol. Its IUPAC name is methyl 4-[2-[(2R)-2-[(E,3S,4S)-3-hydroxy-4-methylnon-1-en-6-ynyl]-5-oxopyrrolidin-1-yl]ethylsulfanyl]butanoate.
| Compound Name | methyl 4-[2-[(2R)-2-[(E,3S,4S)-3-hydroxy-4-methylnon-1-en-6-ynyl]-5-oxopyrrolidin-1-yl]ethylsulfanyl]butanoate |
|---|---|
| PubChem CID | 86296959 |
| Molecular Formula | C21H33NO4S |
| Molecular Weight | 395.57 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | methyl 4-[2-[(2R)-2-[(E,3S,4S)-3-hydroxy-4-methylnon-1-en-6-ynyl]-5-oxopyrrolidin-1-yl]ethylsulfanyl]butanoate |
| SMILES | CCC#CC[C@H](C)[C@H](O)/C=C/[C@H]1CCC(=O)N1CCSCCCC(=O)OC |
| InChI | InChI=1S/C21H33NO4S/c1-4-5-6-8-17(2)19(23)12-10-18-11-13-20(24)22(18)14-16-27-15-7-9-21(25)26-3/h10,12,17-19,23H,4,7-9,11,13-16H2,1-3H3/b12-10+/t17-,18-,19+/m0/s1 |
| InChIKey | LCGIMEDKPRRHLW-DTCDPSDVSA-N |
| XLogP | 3.02 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.57 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|