C22H35NO4 — CID 118896991
7-[(2R)-2-[(3R,4S)-3-hydroxy-4-methyldec-1-en-6-ynyl]-5-oxopyrrolidin-1-yl]heptanoic acid (PubChem CID 118896991) has the molecular formula C22H35NO4 and a molecular weight of 377.53 g/mol. Its IUPAC name is 7-[(2R)-2-[(3R,4S)-3-hydroxy-4-methyldec-1-en-6-ynyl]-5-oxopyrrolidin-1-yl]heptanoic acid.
| Compound Name | 7-[(2R)-2-[(3R,4S)-3-hydroxy-4-methyldec-1-en-6-ynyl]-5-oxopyrrolidin-1-yl]heptanoic acid |
|---|---|
| PubChem CID | 118896991 |
| Molecular Formula | C22H35NO4 |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.26 |
| IUPAC Name | 7-[(2R)-2-[(3R,4S)-3-hydroxy-4-methyldec-1-en-6-ynyl]-5-oxopyrrolidin-1-yl]heptanoic acid |
| SMILES | CCCC#CC[C@H](C)[C@@H](O)C=C[C@H]1CCC(=O)N1CCCCCCC(=O)O |
| InChI | InChI=1S/C22H35NO4/c1-3-4-5-8-11-18(2)20(24)15-13-19-14-16-21(25)23(19)17-10-7-6-9-12-22(26)27/h13,15,18-20,24H,3-4,6-7,9-12,14,16-17H2,1-2H3,(H,26,27)/t18-,19-,20-/m0/s1 |
| InChIKey | CVUPACBLKGWFGO-UFYCRDLUSA-N |
| XLogP | 3.76 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|