C26H39NO4 — CID 118691782
7-[(2R)-2-[(3S,4R)-3-hydroxy-4-methyl-8-phenyloct-1-enyl]-5-oxopyrrolidin-1-yl]heptanoic acid (PubChem CID 118691782) has the molecular formula C26H39NO4 and a molecular weight of 429.60 g/mol. Its IUPAC name is 7-[(2R)-2-[(3S,4R)-3-hydroxy-4-methyl-8-phenyloct-1-enyl]-5-oxopyrrolidin-1-yl]heptanoic acid.
| Compound Name | 7-[(2R)-2-[(3S,4R)-3-hydroxy-4-methyl-8-phenyloct-1-enyl]-5-oxopyrrolidin-1-yl]heptanoic acid |
|---|---|
| PubChem CID | 118691782 |
| Molecular Formula | C26H39NO4 |
| Molecular Weight | 429.60 g/mol |
| Exact Mass | 429.29 |
| IUPAC Name | 7-[(2R)-2-[(3S,4R)-3-hydroxy-4-methyl-8-phenyloct-1-enyl]-5-oxopyrrolidin-1-yl]heptanoic acid |
| SMILES | C[C@H](CCCCc1ccccc1)[C@H](O)C=C[C@H]1CCC(=O)N1CCCCCCC(=O)O |
| InChI | InChI=1S/C26H39NO4/c1-21(11-8-9-14-22-12-5-4-6-13-22)24(28)18-16-23-17-19-25(29)27(23)20-10-3-2-7-15-26(30)31/h4-6,12-13,16,18,21,23-24,28H,2-3,7-11,14-15,17,19-20H2,1H3,(H,30,31)/t21-,23+,24-/m1/s1 |
| InChIKey | CAIUCVVATFKPET-YFNKSVMNSA-N |
| XLogP | 4.98 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.60 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|