C25H39NO4 — CID 155027432
7-[(5R)-2-hydroxy-5-[(E,3S,4S)-3-hydroxy-4-methyl-7-phenylhept-1-enyl]pyrrolidin-1-yl]heptanoic acid (PubChem CID 155027432) has the molecular formula C25H39NO4 and a molecular weight of 417.59 g/mol. Its IUPAC name is 7-[(5R)-2-hydroxy-5-[(E,3S,4S)-3-hydroxy-4-methyl-7-phenylhept-1-enyl]pyrrolidin-1-yl]heptanoic acid.
| Compound Name | 7-[(5R)-2-hydroxy-5-[(E,3S,4S)-3-hydroxy-4-methyl-7-phenylhept-1-enyl]pyrrolidin-1-yl]heptanoic acid |
|---|---|
| PubChem CID | 155027432 |
| Molecular Formula | C25H39NO4 |
| Molecular Weight | 417.59 g/mol |
| Exact Mass | 417.29 |
| IUPAC Name | 7-[(5R)-2-hydroxy-5-[(E,3S,4S)-3-hydroxy-4-methyl-7-phenylhept-1-enyl]pyrrolidin-1-yl]heptanoic acid |
| SMILES | C[C@@H](CCCc1ccccc1)[C@H](O)/C=C/[C@H]1CCC(O)N1CCCCCCC(=O)O |
| InChI | InChI=1S/C25H39NO4/c1-20(10-9-13-21-11-5-4-6-12-21)23(27)17-15-22-16-18-24(28)26(22)19-8-3-2-7-14-25(29)30/h4-6,11-12,15,17,20,22-24,27-28H,2-3,7-10,13-14,16,18-19H2,1H3,(H,29,30)/b17-15+/t20-,22-,23+,24?/m0/s1 |
| InChIKey | GHWHXZOGIQEJME-UYJPWKFMSA-N |
| XLogP | 4.38 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.59 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|