C27H40F2N2O3 — CID 118160335
7-[(5R)-3,3-difluoro-5-[(3S,4S)-3-hydroxy-4-methyl-7-phenylhept-1-enyl]-2-oxopyrrolidin-1-yl]-N-ethylheptanamide (PubChem CID 118160335) has the molecular formula C27H40F2N2O3 and a molecular weight of 478.62 g/mol. Its IUPAC name is 7-[(5R)-3,3-difluoro-5-[(3S,4S)-3-hydroxy-4-methyl-7-phenylhept-1-enyl]-2-oxopyrrolidin-1-yl]-N-ethylheptanamide.
| Compound Name | 7-[(5R)-3,3-difluoro-5-[(3S,4S)-3-hydroxy-4-methyl-7-phenylhept-1-enyl]-2-oxopyrrolidin-1-yl]-N-ethylheptanamide |
|---|---|
| PubChem CID | 118160335 |
| Molecular Formula | C27H40F2N2O3 |
| Molecular Weight | 478.62 g/mol |
| Exact Mass | 478.30 |
| IUPAC Name | 7-[(5R)-3,3-difluoro-5-[(3S,4S)-3-hydroxy-4-methyl-7-phenylhept-1-enyl]-2-oxopyrrolidin-1-yl]-N-ethylheptanamide |
| SMILES | CCNC(=O)CCCCCCN1C(=O)C(F)(F)C[C@@H]1C=C[C@@H](O)[C@@H](C)CCCc1ccccc1 |
| InChI | InChI=1S/C27H40F2N2O3/c1-3-30-25(33)16-9-4-5-10-19-31-23(20-27(28,29)26(31)34)17-18-24(32)21(2)12-11-15-22-13-7-6-8-14-22/h6-8,13-14,17-18,21,23-24,32H,3-5,9-12,15-16,19-20H2,1-2H3,(H,30,33)/t21-,23-,24+/m0/s1 |
| InChIKey | AHEUJCDCESUVAG-OEMFJLHTSA-N |
| XLogP | 4.89 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.62 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|