C26H37F2NO4 — CID 72949739
methyl 7-[(5R)-3,3-difluoro-5-[(E,3S,4S)-3-hydroxy-4-methyl-7-phenylhept-1-enyl]-2-oxopyrrolidin-1-yl]heptanoate (PubChem CID 72949739) has the molecular formula C26H37F2NO4 and a molecular weight of 465.58 g/mol. Its IUPAC name is methyl 7-[(5R)-3,3-difluoro-5-[(E,3S,4S)-3-hydroxy-4-methyl-7-phenylhept-1-enyl]-2-oxopyrrolidin-1-yl]heptanoate.
| Compound Name | methyl 7-[(5R)-3,3-difluoro-5-[(E,3S,4S)-3-hydroxy-4-methyl-7-phenylhept-1-enyl]-2-oxopyrrolidin-1-yl]heptanoate |
|---|---|
| PubChem CID | 72949739 |
| Molecular Formula | C26H37F2NO4 |
| Molecular Weight | 465.58 g/mol |
| Exact Mass | 465.27 |
| IUPAC Name | methyl 7-[(5R)-3,3-difluoro-5-[(E,3S,4S)-3-hydroxy-4-methyl-7-phenylhept-1-enyl]-2-oxopyrrolidin-1-yl]heptanoate |
| SMILES | COC(=O)CCCCCCN1C(=O)C(F)(F)C[C@@H]1/C=C/[C@@H](O)[C@@H](C)CCCc1ccccc1 |
| InChI | InChI=1S/C26H37F2NO4/c1-20(11-10-14-21-12-6-5-7-13-21)23(30)17-16-22-19-26(27,28)25(32)29(22)18-9-4-3-8-15-24(31)33-2/h5-7,12-13,16-17,20,22-23,30H,3-4,8-11,14-15,18-19H2,1-2H3/b17-16+/t20-,22-,23+/m0/s1 |
| InChIKey | JBNVNCQHQOLBKU-PEQASXHNSA-N |
| XLogP | 4.92 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.58 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|