C25H35F2NO4 — CID 72950257
methyl 7-[(5R)-3,3-difluoro-5-[(E)-3-hydroxy-7-phenylhept-1-enyl]-2-oxopyrrolidin-1-yl]heptanoate (PubChem CID 72950257) has the molecular formula C25H35F2NO4 and a molecular weight of 451.55 g/mol. Its IUPAC name is methyl 7-[(5R)-3,3-difluoro-5-[(E)-3-hydroxy-7-phenylhept-1-enyl]-2-oxopyrrolidin-1-yl]heptanoate.
| Compound Name | methyl 7-[(5R)-3,3-difluoro-5-[(E)-3-hydroxy-7-phenylhept-1-enyl]-2-oxopyrrolidin-1-yl]heptanoate |
|---|---|
| PubChem CID | 72950257 |
| Molecular Formula | C25H35F2NO4 |
| Molecular Weight | 451.55 g/mol |
| Exact Mass | 451.25 |
| IUPAC Name | methyl 7-[(5R)-3,3-difluoro-5-[(E)-3-hydroxy-7-phenylhept-1-enyl]-2-oxopyrrolidin-1-yl]heptanoate |
| SMILES | COC(=O)CCCCCCN1C(=O)C(F)(F)C[C@@H]1/C=C/C(O)CCCCc1ccccc1 |
| InChI | InChI=1S/C25H35F2NO4/c1-32-23(30)15-7-2-3-10-18-28-21(19-25(26,27)24(28)31)16-17-22(29)14-9-8-13-20-11-5-4-6-12-20/h4-6,11-12,16-17,21-22,29H,2-3,7-10,13-15,18-19H2,1H3/b17-16+/t21-,22?/m0/s1 |
| InChIKey | AVYDNIUSLHLZJM-KTRCDEGTSA-N |
| XLogP | 4.68 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.55 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|