C28H35F2NO5S — CID 122598015
[5-[3-[(5R)-3,3-difluoro-5-[(E,3S,4S)-3-hydroxy-4-methyl-9-phenylnon-1-enyl]-2-oxopyrrolidin-1-yl]propyl]thiophen-2-yl] hydrogen carbonate (PubChem CID 122598015) has the molecular formula C28H35F2NO5S and a molecular weight of 535.65 g/mol. Its IUPAC name is [5-[3-[(5R)-3,3-difluoro-5-[(E,3S,4S)-3-hydroxy-4-methyl-9-phenylnon-1-enyl]-2-oxopyrrolidin-1-yl]propyl]thiophen-2-yl] hydrogen carbonate.
| Compound Name | [5-[3-[(5R)-3,3-difluoro-5-[(E,3S,4S)-3-hydroxy-4-methyl-9-phenylnon-1-enyl]-2-oxopyrrolidin-1-yl]propyl]thiophen-2-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 122598015 |
| Molecular Formula | C28H35F2NO5S |
| Molecular Weight | 535.65 g/mol |
| Exact Mass | 535.22 |
| IUPAC Name | [5-[3-[(5R)-3,3-difluoro-5-[(E,3S,4S)-3-hydroxy-4-methyl-9-phenylnon-1-enyl]-2-oxopyrrolidin-1-yl]propyl]thiophen-2-yl] hydrogen carbonate |
| SMILES | C[C@@H](CCCCCc1ccccc1)[C@H](O)/C=C/[C@H]1CC(F)(F)C(=O)N1CCCc1ccc(OC(=O)O)s1 |
| InChI | InChI=1S/C28H35F2NO5S/c1-20(9-4-2-5-10-21-11-6-3-7-12-21)24(32)16-14-22-19-28(29,30)26(33)31(22)18-8-13-23-15-17-25(37-23)36-27(34)35/h3,6-7,11-12,14-17,20,22,24,32H,2,4-5,8-10,13,18-19H2,1H3,(H,34,35)/b16-14+/t20-,22-,24+/m0/s1 |
| InChIKey | XKXQNSZWWJWFAJ-WWTZYMIRSA-N |
| XLogP | 6.33 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.65 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|