C28H35F2NO4S — CID 118160012
5-[3-[(5R)-3,3-difluoro-5-[(3S,4S)-3-hydroxy-4-methyl-9-phenylnon-1-enyl]-2-oxopyrrolidin-1-yl]propyl]thiophene-2-carboxylic acid (PubChem CID 118160012) has the molecular formula C28H35F2NO4S and a molecular weight of 519.65 g/mol. Its IUPAC name is 5-[3-[(5R)-3,3-difluoro-5-[(3S,4S)-3-hydroxy-4-methyl-9-phenylnon-1-enyl]-2-oxopyrrolidin-1-yl]propyl]thiophene-2-carboxylic acid.
| Compound Name | 5-[3-[(5R)-3,3-difluoro-5-[(3S,4S)-3-hydroxy-4-methyl-9-phenylnon-1-enyl]-2-oxopyrrolidin-1-yl]propyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 118160012 |
| Molecular Formula | C28H35F2NO4S |
| Molecular Weight | 519.65 g/mol |
| Exact Mass | 519.23 |
| IUPAC Name | 5-[3-[(5R)-3,3-difluoro-5-[(3S,4S)-3-hydroxy-4-methyl-9-phenylnon-1-enyl]-2-oxopyrrolidin-1-yl]propyl]thiophene-2-carboxylic acid |
| SMILES | C[C@@H](CCCCCc1ccccc1)[C@H](O)C=C[C@H]1CC(F)(F)C(=O)N1CCCc1ccc(C(=O)O)s1 |
| InChI | InChI=1S/C28H35F2NO4S/c1-20(9-4-2-5-10-21-11-6-3-7-12-21)24(32)16-14-22-19-28(29,30)27(35)31(22)18-8-13-23-15-17-25(36-23)26(33)34/h3,6-7,11-12,14-17,20,22,24,32H,2,4-5,8-10,13,18-19H2,1H3,(H,33,34)/t20-,22-,24+/m0/s1 |
| InChIKey | AGGYHZMNJSBHQQ-ODGPQVTHSA-N |
| XLogP | 5.97 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.65 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|