C25H35F2NO4 — CID 72949916
7-[(5R)-3,3-difluoro-5-[(E,3R)-3-hydroxy-4-methyl-7-phenylhept-1-enyl]-2-oxopyrrolidin-1-yl]heptanoic acid (PubChem CID 72949916) has the molecular formula C25H35F2NO4 and a molecular weight of 451.55 g/mol. Its IUPAC name is 7-[(5R)-3,3-difluoro-5-[(E,3R)-3-hydroxy-4-methyl-7-phenylhept-1-enyl]-2-oxopyrrolidin-1-yl]heptanoic acid.
| Compound Name | 7-[(5R)-3,3-difluoro-5-[(E,3R)-3-hydroxy-4-methyl-7-phenylhept-1-enyl]-2-oxopyrrolidin-1-yl]heptanoic acid |
|---|---|
| PubChem CID | 72949916 |
| Molecular Formula | C25H35F2NO4 |
| Molecular Weight | 451.55 g/mol |
| Exact Mass | 451.25 |
| IUPAC Name | 7-[(5R)-3,3-difluoro-5-[(E,3R)-3-hydroxy-4-methyl-7-phenylhept-1-enyl]-2-oxopyrrolidin-1-yl]heptanoic acid |
| SMILES | CC(CCCc1ccccc1)[C@@H](O)/C=C/[C@H]1CC(F)(F)C(=O)N1CCCCCCC(=O)O |
| InChI | InChI=1S/C25H35F2NO4/c1-19(10-9-13-20-11-5-4-6-12-20)22(29)16-15-21-18-25(26,27)24(32)28(21)17-8-3-2-7-14-23(30)31/h4-6,11-12,15-16,19,21-22,29H,2-3,7-10,13-14,17-18H2,1H3,(H,30,31)/b16-15+/t19?,21-,22-/m0/s1 |
| InChIKey | UJPIOOJJAAMYNA-HSFNZESZSA-N |
| XLogP | 4.83 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.55 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|