C24H33F2NO4S — CID 118160329
7-[(5R)-3,3-difluoro-5-[(E,3S,4S)-3-hydroxy-4-methyl-6-phenylsulfanylhex-1-enyl]-2-oxopyrrolidin-1-yl]heptanoic acid (PubChem CID 118160329) has the molecular formula C24H33F2NO4S and a molecular weight of 469.59 g/mol. Its IUPAC name is 7-[(5R)-3,3-difluoro-5-[(E,3S,4S)-3-hydroxy-4-methyl-6-phenylsulfanylhex-1-enyl]-2-oxopyrrolidin-1-yl]heptanoic acid.
| Compound Name | 7-[(5R)-3,3-difluoro-5-[(E,3S,4S)-3-hydroxy-4-methyl-6-phenylsulfanylhex-1-enyl]-2-oxopyrrolidin-1-yl]heptanoic acid |
|---|---|
| PubChem CID | 118160329 |
| Molecular Formula | C24H33F2NO4S |
| Molecular Weight | 469.59 g/mol |
| Exact Mass | 469.21 |
| IUPAC Name | 7-[(5R)-3,3-difluoro-5-[(E,3S,4S)-3-hydroxy-4-methyl-6-phenylsulfanylhex-1-enyl]-2-oxopyrrolidin-1-yl]heptanoic acid |
| SMILES | C[C@@H](CCSc1ccccc1)[C@H](O)/C=C/[C@H]1CC(F)(F)C(=O)N1CCCCCCC(=O)O |
| InChI | InChI=1S/C24H33F2NO4S/c1-18(14-16-32-20-9-5-4-6-10-20)21(28)13-12-19-17-24(25,26)23(31)27(19)15-8-3-2-7-11-22(29)30/h4-6,9-10,12-13,18-19,21,28H,2-3,7-8,11,14-17H2,1H3,(H,29,30)/b13-12+/t18-,19-,21+/m0/s1 |
| InChIKey | SNMVMBCOXYKILE-VGZAARGKSA-N |
| XLogP | 4.99 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.59 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|