C27H39NO4 — CID 86300084
methyl (Z)-7-[(2R)-2-[(E,3S,4S)-3-hydroxy-4-methyl-8-phenyloct-1-enyl]-5-oxopyrrolidin-1-yl]hept-5-enoate (PubChem CID 86300084) has the molecular formula C27H39NO4 and a molecular weight of 441.61 g/mol. Its IUPAC name is methyl (Z)-7-[(2R)-2-[(E,3S,4S)-3-hydroxy-4-methyl-8-phenyloct-1-enyl]-5-oxopyrrolidin-1-yl]hept-5-enoate.
| Compound Name | methyl (Z)-7-[(2R)-2-[(E,3S,4S)-3-hydroxy-4-methyl-8-phenyloct-1-enyl]-5-oxopyrrolidin-1-yl]hept-5-enoate |
|---|---|
| PubChem CID | 86300084 |
| Molecular Formula | C27H39NO4 |
| Molecular Weight | 441.61 g/mol |
| Exact Mass | 441.29 |
| IUPAC Name | methyl (Z)-7-[(2R)-2-[(E,3S,4S)-3-hydroxy-4-methyl-8-phenyloct-1-enyl]-5-oxopyrrolidin-1-yl]hept-5-enoate |
| SMILES | COC(=O)CCC/C=C\CN1C(=O)CC[C@@H]1/C=C/[C@@H](O)[C@@H](C)CCCCc1ccccc1 |
| InChI | InChI=1S/C27H39NO4/c1-22(12-9-10-15-23-13-6-5-7-14-23)25(29)19-17-24-18-20-26(30)28(24)21-11-4-3-8-16-27(31)32-2/h4-7,11,13-14,17,19,22,24-25,29H,3,8-10,12,15-16,18,20-21H2,1-2H3/b11-4-,19-17+/t22-,24-,25+/m0/s1 |
| InChIKey | WHPVMCPBOFLVLX-NUEMDALTSA-N |
| XLogP | 4.84 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.61 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|