C45H60N2O8 — CID 161376194
7-[(2R)-2-[(E)-3-hydroxy-4-phenylbut-1-enyl]-6-oxopiperidin-1-yl]hept-5-enoic acid;methyl 7-[(2R)-2-(3-hydroxy-4-phenylbut-1-enyl)-6-oxopiperidin-1-yl]hept-5-enoate (PubChem CID 161376194) has the molecular formula C45H60N2O8 and a molecular weight of 756.98 g/mol. Its IUPAC name is 7-[(2R)-2-[(E)-3-hydroxy-4-phenylbut-1-enyl]-6-oxopiperidin-1-yl]hept-5-enoic acid;methyl 7-[(2R)-2-(3-hydroxy-4-phenylbut-1-enyl)-6-oxopiperidin-1-yl]hept-5-enoate.
| Compound Name | 7-[(2R)-2-[(E)-3-hydroxy-4-phenylbut-1-enyl]-6-oxopiperidin-1-yl]hept-5-enoic acid;methyl 7-[(2R)-2-(3-hydroxy-4-phenylbut-1-enyl)-6-oxopiperidin-1-yl]hept-5-enoate |
|---|---|
| PubChem CID | 161376194 |
| Molecular Formula | C45H60N2O8 |
| Molecular Weight | 756.98 g/mol |
| Exact Mass | 756.43 |
| IUPAC Name | 7-[(2R)-2-[(E)-3-hydroxy-4-phenylbut-1-enyl]-6-oxopiperidin-1-yl]hept-5-enoic acid;methyl 7-[(2R)-2-(3-hydroxy-4-phenylbut-1-enyl)-6-oxopiperidin-1-yl]hept-5-enoate |
| SMILES | COC(=O)CCCC=CCN1C(=O)CCC[C@@H]1C=CC(O)Cc1ccccc1.O=C(O)CCCC=CCN1C(=O)CCC[C@@H]1/C=C/C(O)Cc1ccccc1 |
| InChI | InChI=1S/C23H31NO4.C22H29NO4/c1-28-23(27)14-7-2-3-8-17-24-20(12-9-13-22(24)26)15-16-21(25)18-19-10-5-4-6-11-19;24-20(17-18-9-4-3-5-10-18)15-14-19-11-8-12-21(25)23(19)16-7-2-1-6-13-22(26)27/h3-6,8,10-11,15-16,20-21,25H,2,7,9,12-14,17-18H2,1H3;2-5,7,9-10,14-15,19-20,24H,1,6,8,11-13,16-17H2,(H,26,27)/b;7-2?,15-14+/t20-,21?;19-,20?/m11/s1 |
| InChIKey | VRCODJUICVOVAQ-ACHYNKAFSA-N |
| XLogP | 6.77 |
| TPSA | 144.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.98 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|