C22H28ClNO3 — CID 162283392
7-[(2R)-2-[4-(3-chlorophenyl)-3-hydroxybut-1-enyl]-6-oxopiperidin-1-yl]hept-5-enal (PubChem CID 162283392) has the molecular formula C22H28ClNO3 and a molecular weight of 389.92 g/mol. Its IUPAC name is 7-[(2R)-2-[4-(3-chlorophenyl)-3-hydroxybut-1-enyl]-6-oxopiperidin-1-yl]hept-5-enal.
| Compound Name | 7-[(2R)-2-[4-(3-chlorophenyl)-3-hydroxybut-1-enyl]-6-oxopiperidin-1-yl]hept-5-enal |
|---|---|
| PubChem CID | 162283392 |
| Molecular Formula | C22H28ClNO3 |
| Molecular Weight | 389.92 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | 7-[(2R)-2-[4-(3-chlorophenyl)-3-hydroxybut-1-enyl]-6-oxopiperidin-1-yl]hept-5-enal |
| SMILES | O=CCCCC=CCN1C(=O)CCC[C@@H]1C=CC(O)Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C22H28ClNO3/c23-19-9-6-8-18(16-19)17-21(26)13-12-20-10-7-11-22(27)24(20)14-4-2-1-3-5-15-25/h2,4,6,8-9,12-13,15-16,20-21,26H,1,3,5,7,10-11,14,17H2/t20-,21?/m1/s1 |
| InChIKey | UHQXZMQZZQPUEW-VQCQRNETSA-N |
| XLogP | 4.11 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.92 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|