C22H28FNO4 — CID 162281733
7-[(2R)-2-[4-(2-fluorophenyl)-3-hydroxybut-1-enyl]-6-oxopiperidin-1-yl]hept-5-enoic acid (PubChem CID 162281733) has the molecular formula C22H28FNO4 and a molecular weight of 389.47 g/mol. Its IUPAC name is 7-[(2R)-2-[4-(2-fluorophenyl)-3-hydroxybut-1-enyl]-6-oxopiperidin-1-yl]hept-5-enoic acid.
| Compound Name | 7-[(2R)-2-[4-(2-fluorophenyl)-3-hydroxybut-1-enyl]-6-oxopiperidin-1-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 162281733 |
| Molecular Formula | C22H28FNO4 |
| Molecular Weight | 389.47 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | 7-[(2R)-2-[4-(2-fluorophenyl)-3-hydroxybut-1-enyl]-6-oxopiperidin-1-yl]hept-5-enoic acid |
| SMILES | O=C(O)CCCC=CCN1C(=O)CCC[C@@H]1C=CC(O)Cc1ccccc1F |
| InChI | InChI=1S/C22H28FNO4/c23-20-10-5-4-8-17(20)16-19(25)14-13-18-9-7-11-21(26)24(18)15-6-2-1-3-12-22(27)28/h2,4-6,8,10,13-14,18-19,25H,1,3,7,9,11-12,15-16H2,(H,27,28)/t18-,19?/m1/s1 |
| InChIKey | DUISTGHYODFJCI-MRTLOADZSA-N |
| XLogP | 3.48 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.47 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|