C25H33F2NO4 — CID 23577212
propan-2-yl (E)-7-[2-[(E)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-6-oxopiperidin-1-yl]hept-5-enoate (PubChem CID 23577212) has the molecular formula C25H33F2NO4 and a molecular weight of 449.54 g/mol. Its IUPAC name is propan-2-yl (E)-7-[2-[(E)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-6-oxopiperidin-1-yl]hept-5-enoate.
| Compound Name | propan-2-yl (E)-7-[2-[(E)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-6-oxopiperidin-1-yl]hept-5-enoate |
|---|---|
| PubChem CID | 23577212 |
| Molecular Formula | C25H33F2NO4 |
| Molecular Weight | 449.54 g/mol |
| Exact Mass | 449.24 |
| IUPAC Name | propan-2-yl (E)-7-[2-[(E)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-6-oxopiperidin-1-yl]hept-5-enoate |
| SMILES | CC(C)OC(=O)CCC/C=C/CN1C(=O)CCCC1/C=C/C(O)C(F)(F)c1ccccc1 |
| InChI | InChI=1S/C25H33F2NO4/c1-19(2)32-24(31)15-8-3-4-9-18-28-21(13-10-14-23(28)30)16-17-22(29)25(26,27)20-11-6-5-7-12-20/h4-7,9,11-12,16-17,19,21-22,29H,3,8,10,13-15,18H2,1-2H3/b9-4+,17-16+ |
| InChIKey | DRBXDZLBKBRGDF-AKQMEFEBSA-N |
| XLogP | 4.75 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.54 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|