C21H25F2NO4S — CID 67317324
2-[(Z)-4-[(2R)-2-[(E,3R)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-6-oxopiperidin-1-yl]but-2-enyl]sulfanylacetic acid (PubChem CID 67317324) has the molecular formula C21H25F2NO4S and a molecular weight of 425.50 g/mol. Its IUPAC name is 2-[(Z)-4-[(2R)-2-[(E,3R)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-6-oxopiperidin-1-yl]but-2-enyl]sulfanylacetic acid.
| Compound Name | 2-[(Z)-4-[(2R)-2-[(E,3R)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-6-oxopiperidin-1-yl]but-2-enyl]sulfanylacetic acid |
|---|---|
| PubChem CID | 67317324 |
| Molecular Formula | C21H25F2NO4S |
| Molecular Weight | 425.50 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | 2-[(Z)-4-[(2R)-2-[(E,3R)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-6-oxopiperidin-1-yl]but-2-enyl]sulfanylacetic acid |
| SMILES | O=C(O)CSC/C=C\CN1C(=O)CCC[C@@H]1/C=C/[C@@H](O)C(F)(F)c1ccccc1 |
| InChI | InChI=1S/C21H25F2NO4S/c22-21(23,16-7-2-1-3-8-16)18(25)12-11-17-9-6-10-19(26)24(17)13-4-5-14-29-15-20(27)28/h1-5,7-8,11-12,17-18,25H,6,9-10,13-15H2,(H,27,28)/b5-4-,12-11+/t17-,18-/m1/s1 |
| InChIKey | KWJWEESQEYNENM-KYEAHMHCSA-N |
| XLogP | 3.45 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.50 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|