About 4-[(2R)-2-[(3R)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-5-oxopyrrolidin-1-yl]butyl cyanate
4-[(2R)-2-[(3R)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-5-oxopyrrolidin-1-yl]butyl cyanate (PubChem CID 90787596) has the molecular formula C19H22F2N2O3
and a molecular weight of 364.39 g/mol. Its IUPAC name is 4-[(2R)-2-[(3R)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-5-oxopyrrolidin-1-yl]butyl cyanate.
Molecular Properties
| Compound Name | 4-[(2R)-2-[(3R)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-5-oxopyrrolidin-1-yl]butyl cyanate |
| PubChem CID | 90787596 |
| Molecular Formula | C19H22F2N2O3 |
| Molecular Weight | 364.39 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | 4-[(2R)-2-[(3R)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-5-oxopyrrolidin-1-yl]butyl cyanate |
| SMILES | N#COCCCCN1C(=O)CC[C@@H]1C=C[C@@H](O)C(F)(F)c1ccccc1 |
| InChI | InChI=1S/C19H22F2N2O3/c20-19(21,15-6-2-1-3-7-15)17(24)10-8-16-9-11-18(25)23(16)12-4-5-13-26-14-22/h1-3,6-8,10,16-17,24H,4-5,9,11-13H2/t16-,17+/m0/s1 |
| InChIKey | KAYGFVFDSNGNMK-DLBZAZTESA-N |
| XLogP | 2.96 |
| TPSA | 73.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.39 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(2R)-2-[(3R)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-5-oxopyrrolidin-1-yl]butyl cyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2R)-2-[(3R)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-5-oxopyrrolidin-1-yl]butyl cyanate?
The IUPAC name of 4-[(2R)-2-[(3R)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-5-oxopyrrolidin-1-yl]butyl cyanate (CID 90787596) is 4-[(2R)-2-[(3R)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-5-oxopyrrolidin-1-yl]butyl cyanate.
What is the SMILES notation for 4-[(2R)-2-[(3R)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-5-oxopyrrolidin-1-yl]butyl cyanate?
The canonical SMILES for 4-[(2R)-2-[(3R)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-5-oxopyrrolidin-1-yl]butyl cyanate is N#COCCCCN1C(=O)CC[C@@H]1C=C[C@@H](O)C(F)(F)c1ccccc1.
What is the InChIKey of 4-[(2R)-2-[(3R)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-5-oxopyrrolidin-1-yl]butyl cyanate?
The InChIKey is KAYGFVFDSNGNMK-DLBZAZTESA-N. The full InChI is InChI=1S/C19H22F2N2O3/c20-19(21,15-6-2-1-3-7-15)17(24)10-8-16-9-11-18(25)23(16)12-4-5-13-26-14-22/h1-3,6-8,10,16-17,24H,4-5,9,11-13H2/t16-,17+/m0/s1.
What are the key properties of 4-[(2R)-2-[(3R)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-5-oxopyrrolidin-1-yl]butyl cyanate?
4-[(2R)-2-[(3R)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-5-oxopyrrolidin-1-yl]butyl cyanate has a molecular weight of 364.39 g/mol, XLogP of 2.96, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2R)-2-[(3R)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-5-oxopyrrolidin-1-yl]butyl cyanate is sourced from PubChem (CID 90787596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).