C26H30F2N2O5 — CID 73086962
2-[4-[3-benzyl-5-(4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl)-2-oxoimidazolidin-1-yl]butoxy]acetic acid (PubChem CID 73086962) has the molecular formula C26H30F2N2O5 and a molecular weight of 488.53 g/mol. Its IUPAC name is 2-[4-[3-benzyl-5-(4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl)-2-oxoimidazolidin-1-yl]butoxy]acetic acid.
| Compound Name | 2-[4-[3-benzyl-5-(4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl)-2-oxoimidazolidin-1-yl]butoxy]acetic acid |
|---|---|
| PubChem CID | 73086962 |
| Molecular Formula | C26H30F2N2O5 |
| Molecular Weight | 488.53 g/mol |
| Exact Mass | 488.21 |
| IUPAC Name | 2-[4-[3-benzyl-5-(4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl)-2-oxoimidazolidin-1-yl]butoxy]acetic acid |
| SMILES | O=C(O)COCCCCN1C(=O)N(Cc2ccccc2)CC1C=CC(O)C(F)(F)c1ccccc1 |
| InChI | InChI=1S/C26H30F2N2O5/c27-26(28,21-11-5-2-6-12-21)23(31)14-13-22-18-29(17-20-9-3-1-4-10-20)25(34)30(22)15-7-8-16-35-19-24(32)33/h1-6,9-14,22-23,31H,7-8,15-19H2,(H,32,33) |
| InChIKey | GDQROIFHQGPTAJ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 90.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.53 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|