C26H35N2O5P — CID 10074138
6-[(5S)-3-benzyl-5-[(E)-3-hydroxy-4-phenylbut-1-enyl]-2-oxoimidazolidin-1-yl]hexylphosphonic acid (PubChem CID 10074138) has the molecular formula C26H35N2O5P and a molecular weight of 486.55 g/mol. Its IUPAC name is 6-[(5S)-3-benzyl-5-[(E)-3-hydroxy-4-phenylbut-1-enyl]-2-oxoimidazolidin-1-yl]hexylphosphonic acid.
| Compound Name | 6-[(5S)-3-benzyl-5-[(E)-3-hydroxy-4-phenylbut-1-enyl]-2-oxoimidazolidin-1-yl]hexylphosphonic acid |
|---|---|
| PubChem CID | 10074138 |
| Molecular Formula | C26H35N2O5P |
| Molecular Weight | 486.55 g/mol |
| Exact Mass | 486.23 |
| IUPAC Name | 6-[(5S)-3-benzyl-5-[(E)-3-hydroxy-4-phenylbut-1-enyl]-2-oxoimidazolidin-1-yl]hexylphosphonic acid |
| SMILES | O=C1N(Cc2ccccc2)C[C@H](/C=C/C(O)Cc2ccccc2)N1CCCCCCP(=O)(O)O |
| InChI | InChI=1S/C26H35N2O5P/c29-25(19-22-11-5-3-6-12-22)16-15-24-21-27(20-23-13-7-4-8-14-23)26(30)28(24)17-9-1-2-10-18-34(31,32)33/h3-8,11-16,24-25,29H,1-2,9-10,17-21H2,(H2,31,32,33)/b16-15+/t24-,25?/m0/s1 |
| InChIKey | MXQCTCRVPRWJMR-ZHFLYEGUSA-N |
| XLogP | 4.19 |
| TPSA | 101.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.55 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|