C22H29ClNO5PS — CID 91536692
6-[(2R)-2-[5-(3-chloro-1-benzothiophen-2-yl)-3-hydroxypent-1-enyl]-4-oxoazetidin-1-yl]hexylphosphonic acid (PubChem CID 91536692) has the molecular formula C22H29ClNO5PS and a molecular weight of 485.97 g/mol. Its IUPAC name is 6-[(2R)-2-[5-(3-chloro-1-benzothiophen-2-yl)-3-hydroxypent-1-enyl]-4-oxoazetidin-1-yl]hexylphosphonic acid.
| Compound Name | 6-[(2R)-2-[5-(3-chloro-1-benzothiophen-2-yl)-3-hydroxypent-1-enyl]-4-oxoazetidin-1-yl]hexylphosphonic acid |
|---|---|
| PubChem CID | 91536692 |
| Molecular Formula | C22H29ClNO5PS |
| Molecular Weight | 485.97 g/mol |
| Exact Mass | 485.12 |
| IUPAC Name | 6-[(2R)-2-[5-(3-chloro-1-benzothiophen-2-yl)-3-hydroxypent-1-enyl]-4-oxoazetidin-1-yl]hexylphosphonic acid |
| SMILES | O=C1C[C@H](C=CC(O)CCc2sc3ccccc3c2Cl)N1CCCCCCP(=O)(O)O |
| InChI | InChI=1S/C22H29ClNO5PS/c23-22-18-7-3-4-8-19(18)31-20(22)12-11-17(25)10-9-16-15-21(26)24(16)13-5-1-2-6-14-30(27,28)29/h3-4,7-10,16-17,25H,1-2,5-6,11-15H2,(H2,27,28,29)/t16-,17?/m0/s1 |
| InChIKey | TZWHKIXNWZSRGD-BHWOMJMDSA-N |
| XLogP | 4.74 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.97 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|