C27H33ClO4S — CID 88563497
(Z)-7-[(1R,4S,5R)-5-[(E,3R)-5-(3-chloro-1-benzothiophen-2-yl)-3-hydroxypent-1-enyl]-4-hydroxy-3,3-dimethyl-2-oxocyclopentyl]hept-5-enal (PubChem CID 88563497) has the molecular formula C27H33ClO4S and a molecular weight of 489.08 g/mol. Its IUPAC name is (Z)-7-[(1R,4S,5R)-5-[(E,3R)-5-(3-chloro-1-benzothiophen-2-yl)-3-hydroxypent-1-enyl]-4-hydroxy-3,3-dimethyl-2-oxocyclopentyl]hept-5-enal.
| Compound Name | (Z)-7-[(1R,4S,5R)-5-[(E,3R)-5-(3-chloro-1-benzothiophen-2-yl)-3-hydroxypent-1-enyl]-4-hydroxy-3,3-dimethyl-2-oxocyclopentyl]hept-5-enal |
|---|---|
| PubChem CID | 88563497 |
| Molecular Formula | C27H33ClO4S |
| Molecular Weight | 489.08 g/mol |
| Exact Mass | 488.18 |
| IUPAC Name | (Z)-7-[(1R,4S,5R)-5-[(E,3R)-5-(3-chloro-1-benzothiophen-2-yl)-3-hydroxypent-1-enyl]-4-hydroxy-3,3-dimethyl-2-oxocyclopentyl]hept-5-enal |
| SMILES | CC1(C)C(=O)[C@H](C/C=C\CCCC=O)[C@@H](/C=C/[C@H](O)CCc2sc3ccccc3c2Cl)[C@@H]1O |
| InChI | InChI=1S/C27H33ClO4S/c1-27(2)25(31)19(10-6-4-3-5-9-17-29)20(26(27)32)15-13-18(30)14-16-23-24(28)21-11-7-8-12-22(21)33-23/h4,6-8,11-13,15,17-20,26,30,32H,3,5,9-10,14,16H2,1-2H3/b6-4-,15-13+/t18-,19+,20+,26-/m0/s1 |
| InChIKey | PHOYTPLESSJEHE-UTQTVJKOSA-N |
| XLogP | 5.92 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.08 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|