C31H41ClO5S — CID 71737139
propan-2-yl (Z)-8-[(1R,4S,5R)-5-[(E,3R)-5-(3-chloro-1-benzothiophen-2-yl)-3-hydroxypent-1-enyl]-4-hydroxy-3,3-dimethyl-2-oxocyclopentyl]oct-6-enoate (PubChem CID 71737139) has the molecular formula C31H41ClO5S and a molecular weight of 561.18 g/mol. Its IUPAC name is propan-2-yl (Z)-8-[(1R,4S,5R)-5-[(E,3R)-5-(3-chloro-1-benzothiophen-2-yl)-3-hydroxypent-1-enyl]-4-hydroxy-3,3-dimethyl-2-oxocyclopentyl]oct-6-enoate.
| Compound Name | propan-2-yl (Z)-8-[(1R,4S,5R)-5-[(E,3R)-5-(3-chloro-1-benzothiophen-2-yl)-3-hydroxypent-1-enyl]-4-hydroxy-3,3-dimethyl-2-oxocyclopentyl]oct-6-enoate |
|---|---|
| PubChem CID | 71737139 |
| Molecular Formula | C31H41ClO5S |
| Molecular Weight | 561.18 g/mol |
| Exact Mass | 560.24 |
| IUPAC Name | propan-2-yl (Z)-8-[(1R,4S,5R)-5-[(E,3R)-5-(3-chloro-1-benzothiophen-2-yl)-3-hydroxypent-1-enyl]-4-hydroxy-3,3-dimethyl-2-oxocyclopentyl]oct-6-enoate |
| SMILES | CC(C)OC(=O)CCCC/C=C\C[C@H]1C(=O)C(C)(C)[C@@H](O)[C@@H]1/C=C/[C@H](O)CCc1sc2ccccc2c1Cl |
| InChI | InChI=1S/C31H41ClO5S/c1-20(2)37-27(34)15-9-7-5-6-8-12-22-23(30(36)31(3,4)29(22)35)18-16-21(33)17-19-26-28(32)24-13-10-11-14-25(24)38-26/h6,8,10-11,13-14,16,18,20-23,30,33,36H,5,7,9,12,15,17,19H2,1-4H3/b8-6-,18-16+/t21-,22+,23+,30-/m0/s1 |
| InChIKey | FXOAUNZDAWMLQH-KMCINNFQSA-N |
| XLogP | 7.06 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.18 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|