C28H33ClO5S — CID 66601968
prop-2-enyl 7-[(1R,2R,3R)-2-[5-(3-chloro-1-benzothiophen-2-yl)-3-hydroxypent-1-enyl]-3-hydroxy-5-oxocyclopentyl]hept-5-enoate (PubChem CID 66601968) has the molecular formula C28H33ClO5S and a molecular weight of 517.09 g/mol. Its IUPAC name is prop-2-enyl 7-[(1R,2R,3R)-2-[5-(3-chloro-1-benzothiophen-2-yl)-3-hydroxypent-1-enyl]-3-hydroxy-5-oxocyclopentyl]hept-5-enoate.
| Compound Name | prop-2-enyl 7-[(1R,2R,3R)-2-[5-(3-chloro-1-benzothiophen-2-yl)-3-hydroxypent-1-enyl]-3-hydroxy-5-oxocyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 66601968 |
| Molecular Formula | C28H33ClO5S |
| Molecular Weight | 517.09 g/mol |
| Exact Mass | 516.17 |
| IUPAC Name | prop-2-enyl 7-[(1R,2R,3R)-2-[5-(3-chloro-1-benzothiophen-2-yl)-3-hydroxypent-1-enyl]-3-hydroxy-5-oxocyclopentyl]hept-5-enoate |
| SMILES | C=CCOC(=O)CCCC=CC[C@H]1C(=O)C[C@@H](O)[C@@H]1C=CC(O)CCc1sc2ccccc2c1Cl |
| InChI | InChI=1S/C28H33ClO5S/c1-2-17-34-27(33)12-6-4-3-5-9-20-21(24(32)18-23(20)31)15-13-19(30)14-16-26-28(29)22-10-7-8-11-25(22)35-26/h2-3,5,7-8,10-11,13,15,19-21,24,30,32H,1,4,6,9,12,14,16-18H2/t19?,20-,21-,24-/m1/s1 |
| InChIKey | NEORWJSQVLICEI-VIMIFYJLSA-N |
| XLogP | 5.82 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.09 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|