C27H33ClO5S — CID 70806257
methyl (Z)-7-[(1R,3R)-2-[(E)-5-(3-chloro-1-benzothiophen-2-yl)-3-hydroxypent-1-enyl]-3-(hydroxymethyl)-5-oxocyclopentyl]hept-5-enoate (PubChem CID 70806257) has the molecular formula C27H33ClO5S and a molecular weight of 505.08 g/mol. Its IUPAC name is methyl (Z)-7-[(1R,3R)-2-[(E)-5-(3-chloro-1-benzothiophen-2-yl)-3-hydroxypent-1-enyl]-3-(hydroxymethyl)-5-oxocyclopentyl]hept-5-enoate.
| Compound Name | methyl (Z)-7-[(1R,3R)-2-[(E)-5-(3-chloro-1-benzothiophen-2-yl)-3-hydroxypent-1-enyl]-3-(hydroxymethyl)-5-oxocyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 70806257 |
| Molecular Formula | C27H33ClO5S |
| Molecular Weight | 505.08 g/mol |
| Exact Mass | 504.17 |
| IUPAC Name | methyl (Z)-7-[(1R,3R)-2-[(E)-5-(3-chloro-1-benzothiophen-2-yl)-3-hydroxypent-1-enyl]-3-(hydroxymethyl)-5-oxocyclopentyl]hept-5-enoate |
| SMILES | COC(=O)CCC/C=C\C[C@H]1C(=O)C[C@@H](CO)C1/C=C/C(O)CCc1sc2ccccc2c1Cl |
| InChI | InChI=1S/C27H33ClO5S/c1-33-26(32)11-5-3-2-4-8-21-20(18(17-29)16-23(21)31)14-12-19(30)13-15-25-27(28)22-9-6-7-10-24(22)34-25/h2,4,6-7,9-10,12,14,18-21,29-30H,3,5,8,11,13,15-17H2,1H3/b4-2-,14-12+/t18-,19?,20?,21+/m0/s1 |
| InChIKey | XOKZYUCALFOVPX-UDIYTTIQSA-N |
| XLogP | 5.51 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.08 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|