C26H31ClO5S — CID 91514437
deuteriomethyl 7-[(1R,5R)-5-[5-(3-chloro-1-benzothiophen-2-yl)-3-hydroxypent-1-enyl]-3-hydroxy-2-oxocyclopentyl]hept-5-enoate (PubChem CID 91514437) has the molecular formula C26H31ClO5S and a molecular weight of 492.06 g/mol. Its IUPAC name is deuteriomethyl 7-[(1R,5R)-5-[5-(3-chloro-1-benzothiophen-2-yl)-3-hydroxypent-1-enyl]-3-hydroxy-2-oxocyclopentyl]hept-5-enoate.
| Compound Name | deuteriomethyl 7-[(1R,5R)-5-[5-(3-chloro-1-benzothiophen-2-yl)-3-hydroxypent-1-enyl]-3-hydroxy-2-oxocyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 91514437 |
| Molecular Formula | C26H31ClO5S |
| Molecular Weight | 492.06 g/mol |
| Exact Mass | 491.16 |
| IUPAC Name | deuteriomethyl 7-[(1R,5R)-5-[5-(3-chloro-1-benzothiophen-2-yl)-3-hydroxypent-1-enyl]-3-hydroxy-2-oxocyclopentyl]hept-5-enoate |
| SMILES | [2H]COC(=O)CCCC=CC[C@H]1C(=O)C(O)C[C@@H]1C=CC(O)CCc1sc2ccccc2c1Cl |
| InChI | InChI=1S/C26H31ClO5S/c1-32-24(30)11-5-3-2-4-8-19-17(16-21(29)26(19)31)12-13-18(28)14-15-23-25(27)20-9-6-7-10-22(20)33-23/h2,4,6-7,9-10,12-13,17-19,21,28-29H,3,5,8,11,14-16H2,1H3/t17-,18?,19+,21?/m0/s1/i1D |
| InChIKey | ALYOHLGFXAPIFR-KDPLYNONSA-N |
| XLogP | 5.26 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.06 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|