C28H33ClO5S — CID 91040842
deuteriomethyl 7-[(1R,4S,5R)-5-[5-(3-chloro-1-benzothiophen-2-yl)-3-hydroxypent-1-enyl]-4-hydroxy-3,3-dimethyl-2-oxocyclopentyl]hept-5-ynoate (PubChem CID 91040842) has the molecular formula C28H33ClO5S and a molecular weight of 518.09 g/mol. Its IUPAC name is deuteriomethyl 7-[(1R,4S,5R)-5-[5-(3-chloro-1-benzothiophen-2-yl)-3-hydroxypent-1-enyl]-4-hydroxy-3,3-dimethyl-2-oxocyclopentyl]hept-5-ynoate.
| Compound Name | deuteriomethyl 7-[(1R,4S,5R)-5-[5-(3-chloro-1-benzothiophen-2-yl)-3-hydroxypent-1-enyl]-4-hydroxy-3,3-dimethyl-2-oxocyclopentyl]hept-5-ynoate |
|---|---|
| PubChem CID | 91040842 |
| Molecular Formula | C28H33ClO5S |
| Molecular Weight | 518.09 g/mol |
| Exact Mass | 517.18 |
| IUPAC Name | deuteriomethyl 7-[(1R,4S,5R)-5-[5-(3-chloro-1-benzothiophen-2-yl)-3-hydroxypent-1-enyl]-4-hydroxy-3,3-dimethyl-2-oxocyclopentyl]hept-5-ynoate |
| SMILES | [2H]COC(=O)CCCC#CC[C@H]1C(=O)C(C)(C)[C@@H](O)[C@@H]1C=CC(O)CCc1sc2ccccc2c1Cl |
| InChI | InChI=1S/C28H33ClO5S/c1-28(2)26(32)19(10-6-4-5-7-13-24(31)34-3)20(27(28)33)16-14-18(30)15-17-23-25(29)21-11-8-9-12-22(21)35-23/h8-9,11-12,14,16,18-20,27,30,33H,5,7,10,13,15,17H2,1-3H3/t18?,19-,20-,27+/m1/s1/i3D |
| InChIKey | YCCZFNGAOPQUGR-ZJJAGZDRSA-N |
| XLogP | 5.34 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.09 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|