C30H39ClO5S — CID 67018014
propan-2-yl 7-[(1R,4S,5R)-5-[(3R)-5-(3-chloro-1-benzothiophen-2-yl)-3-hydroxypent-1-enyl]-4-hydroxy-3,3-dimethyl-2-oxocyclopentyl]hept-5-enoate (PubChem CID 67018014) has the molecular formula C30H39ClO5S and a molecular weight of 547.16 g/mol. Its IUPAC name is propan-2-yl 7-[(1R,4S,5R)-5-[(3R)-5-(3-chloro-1-benzothiophen-2-yl)-3-hydroxypent-1-enyl]-4-hydroxy-3,3-dimethyl-2-oxocyclopentyl]hept-5-enoate.
| Compound Name | propan-2-yl 7-[(1R,4S,5R)-5-[(3R)-5-(3-chloro-1-benzothiophen-2-yl)-3-hydroxypent-1-enyl]-4-hydroxy-3,3-dimethyl-2-oxocyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 67018014 |
| Molecular Formula | C30H39ClO5S |
| Molecular Weight | 547.16 g/mol |
| Exact Mass | 546.22 |
| IUPAC Name | propan-2-yl 7-[(1R,4S,5R)-5-[(3R)-5-(3-chloro-1-benzothiophen-2-yl)-3-hydroxypent-1-enyl]-4-hydroxy-3,3-dimethyl-2-oxocyclopentyl]hept-5-enoate |
| SMILES | CC(C)OC(=O)CCCC=CC[C@H]1C(=O)C(C)(C)[C@@H](O)[C@@H]1C=C[C@H](O)CCc1sc2ccccc2c1Cl |
| InChI | InChI=1S/C30H39ClO5S/c1-19(2)36-26(33)14-8-6-5-7-11-21-22(29(35)30(3,4)28(21)34)17-15-20(32)16-18-25-27(31)23-12-9-10-13-24(23)37-25/h5,7,9-10,12-13,15,17,19-22,29,32,35H,6,8,11,14,16,18H2,1-4H3/t20-,21+,22+,29-/m0/s1 |
| InChIKey | LQVGHVWGTBFHOQ-OTQKSDDRSA-N |
| XLogP | 6.67 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.16 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|