C30H41ClO5S — CID 155063022
propan-2-yl (Z)-7-[(1R,4S,5R)-5-[(E,3R)-5-(3-chloro-6,7-dihydro-1-benzothiophen-2-yl)-3-hydroxypent-1-enyl]-4-hydroxy-3,3-dimethyl-2-oxocyclopentyl]hept-5-enoate (PubChem CID 155063022) has the molecular formula C30H41ClO5S and a molecular weight of 549.17 g/mol. Its IUPAC name is propan-2-yl (Z)-7-[(1R,4S,5R)-5-[(E,3R)-5-(3-chloro-6,7-dihydro-1-benzothiophen-2-yl)-3-hydroxypent-1-enyl]-4-hydroxy-3,3-dimethyl-2-oxocyclopentyl]hept-5-enoate.
| Compound Name | propan-2-yl (Z)-7-[(1R,4S,5R)-5-[(E,3R)-5-(3-chloro-6,7-dihydro-1-benzothiophen-2-yl)-3-hydroxypent-1-enyl]-4-hydroxy-3,3-dimethyl-2-oxocyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 155063022 |
| Molecular Formula | C30H41ClO5S |
| Molecular Weight | 549.17 g/mol |
| Exact Mass | 548.24 |
| IUPAC Name | propan-2-yl (Z)-7-[(1R,4S,5R)-5-[(E,3R)-5-(3-chloro-6,7-dihydro-1-benzothiophen-2-yl)-3-hydroxypent-1-enyl]-4-hydroxy-3,3-dimethyl-2-oxocyclopentyl]hept-5-enoate |
| SMILES | CC(C)OC(=O)CCC/C=C\C[C@H]1C(=O)C(C)(C)[C@@H](O)[C@@H]1/C=C/[C@H](O)CCc1sc2c(c1Cl)C=CCC2 |
| InChI | InChI=1S/C30H41ClO5S/c1-19(2)36-26(33)14-8-6-5-7-11-21-22(29(35)30(3,4)28(21)34)17-15-20(32)16-18-25-27(31)23-12-9-10-13-24(23)37-25/h5,7,9,12,15,17,19-22,29,32,35H,6,8,10-11,13-14,16,18H2,1-4H3/b7-5-,17-15+/t20-,21+,22+,29-/m0/s1 |
| InChIKey | VESFFPHISOZRIL-CKPLMTIHSA-N |
| XLogP | 6.48 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.17 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|