C26H37BrO5 — CID 10369032
propan-2-yl (Z)-7-[(1R,2R,3R,5S)-2-[(E,3R)-5-(3-bromophenyl)-3-hydroxypent-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoate (PubChem CID 10369032) has the molecular formula C26H37BrO5 and a molecular weight of 509.48 g/mol. Its IUPAC name is propan-2-yl (Z)-7-[(1R,2R,3R,5S)-2-[(E,3R)-5-(3-bromophenyl)-3-hydroxypent-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoate.
| Compound Name | propan-2-yl (Z)-7-[(1R,2R,3R,5S)-2-[(E,3R)-5-(3-bromophenyl)-3-hydroxypent-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 10369032 |
| Molecular Formula | C26H37BrO5 |
| Molecular Weight | 509.48 g/mol |
| Exact Mass | 508.18 |
| IUPAC Name | propan-2-yl (Z)-7-[(1R,2R,3R,5S)-2-[(E,3R)-5-(3-bromophenyl)-3-hydroxypent-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoate |
| SMILES | CC(C)OC(=O)CCC/C=C\C[C@@H]1[C@@H](/C=C/[C@H](O)CCc2cccc(Br)c2)[C@H](O)C[C@@H]1O |
| InChI | InChI=1S/C26H37BrO5/c1-18(2)32-26(31)11-6-4-3-5-10-22-23(25(30)17-24(22)29)15-14-21(28)13-12-19-8-7-9-20(27)16-19/h3,5,7-9,14-16,18,21-25,28-30H,4,6,10-13,17H2,1-2H3/b5-3-,15-14+/t21-,22-,23-,24+,25-/m1/s1 |
| InChIKey | VGDUBFZGFSYEKB-BMBLLYGXSA-N |
| XLogP | 4.72 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.48 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|